CymitQuimica logo

CAS 1204296-38-7

:

4-[3-(2-Pyridinyl)-1,2,4-triazolo[4,3-b]pyridazin-6-yl]benzenamine

Description:
4-[3-(2-Pyridinyl)-1,2,4-triazolo[4,3-b]pyridazin-6-yl]benzenamine, with the CAS number 1204296-38-7, is a chemical compound characterized by its complex structure, which includes a benzenamine moiety and a triazolo-pyridazinyl group. This compound features multiple heterocyclic rings, specifically a pyridine and a triazole, contributing to its potential biological activity and interaction with various biological targets. The presence of nitrogen atoms in its structure may influence its solubility and reactivity, making it of interest in medicinal chemistry. Such compounds often exhibit properties that can be leveraged for pharmaceutical applications, including anti-inflammatory, antimicrobial, or anticancer activities. The specific arrangement of functional groups and the overall molecular geometry can significantly affect its pharmacokinetics and pharmacodynamics. As with many heterocyclic compounds, the synthesis and characterization of this substance would involve techniques such as NMR spectroscopy, mass spectrometry, and crystallography to confirm its structure and purity.
Formula:C16H12N6
InChI:InChI=1S/C16H12N6/c17-12-6-4-11(5-7-12)13-8-9-15-19-20-16(22(15)21-13)14-3-1-2-10-18-14/h1-10H,17H2
InChI key:InChIKey=XGPJNMRTSFNBCB-UHFFFAOYSA-N
SMILES:NC1=CC=C(C2=NN3C(=NN=C3C=C2)C4=CC=CC=N4)C=C1
Synonyms:
  • 4-[3-(2-Pyridinyl)-1,2,4-triazolo[4,3-b]pyridazin-6-yl]benzenamine
  • Benzenamine, 4-[3-(2-pyridinyl)-1,2,4-triazolo[4,3-b]pyridazin-6-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.