CymitQuimica logo

CAS 1204296-45-6

:

5-(Chloromethyl)-3-(3,4-dimethoxyphenyl)-2-oxazolidinone

Description:
5-(Chloromethyl)-3-(3,4-dimethoxyphenyl)-2-oxazolidinone is a chemical compound characterized by its oxazolidinone core structure, which is a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. The presence of a chloromethyl group indicates that it has a chlorine atom attached to a methylene group, enhancing its reactivity and potential for further chemical modifications. The compound also features a 3,4-dimethoxyphenyl substituent, which contributes to its aromatic character and may influence its solubility and biological activity. This compound is likely to exhibit properties typical of oxazolidinones, such as potential antimicrobial activity, and may be of interest in medicinal chemistry. Its specific reactivity, stability, and interactions would depend on the functional groups present and the overall molecular structure. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the presence of the chloromethyl group, which can be reactive.
Formula:C12H14ClNO4
InChI:InChI=1S/C12H14ClNO4/c1-16-10-4-3-8(5-11(10)17-2)14-7-9(6-13)18-12(14)15/h3-5,9H,6-7H2,1-2H3
InChI key:InChIKey=DZHSXMZHABDQHC-UHFFFAOYSA-N
SMILES:O=C1N(CC(CCl)O1)C2=CC(OC)=C(OC)C=C2
Synonyms:
  • 5-(Chloromethyl)-3-(3,4-dimethoxyphenyl)-2-oxazolidinone
  • 2-Oxazolidinone, 5-(chloromethyl)-3-(3,4-dimethoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.