CAS 1204296-62-7
:1-(4-Fluorophenyl)-2,5-dihydro-5-oxo-1H-pyrazole-3-carboxylic acid
Description:
1-(4-Fluorophenyl)-2,5-dihydro-5-oxo-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its biological activity. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of the keto group (5-oxo) may play a role in its reactivity and stability. Overall, the unique combination of functional groups and structural features makes this compound a valuable candidate for further research in drug development and chemical synthesis.
Formula:C10H7FN2O3
InChI:InChI=1S/C10H7FN2O3/c11-6-1-3-7(4-2-6)13-9(14)5-8(12-13)10(15)16/h1-5,12H,(H,15,16)
InChI key:InChIKey=VJEBXHBTKLPUQG-UHFFFAOYSA-N
SMILES:O=C1N(NC(C(O)=O)=C1)C2=CC=C(F)C=C2
Synonyms:- 1H-Pyrazole-3-carboxylic acid, 1-(4-fluorophenyl)-2,5-dihydro-5-oxo-
- 1-(4-Fluorophenyl)-2,5-dihydro-5-oxo-1H-pyrazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.