CymitQuimica logo

CAS 1204296-84-3

:

5,11-Dihydro-6H-pyrido[2,3-b][1,4]benzodiazepine-6-thione

Description:
5,11-Dihydro-6H-pyrido[2,3-b][1,4]benzodiazepine-6-thione is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both benzodiazepine and pyridine moieties. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which can influence its reactivity and biological activity. The presence of nitrogen atoms in the benzodiazepine ring contributes to its potential pharmacological properties, making it of interest in medicinal chemistry. The compound's unique structure may exhibit various interactions with biological targets, potentially leading to applications in therapeutic areas such as neuropharmacology or anti-anxiety treatments. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many heterocycles, the electronic properties imparted by the nitrogen and sulfur atoms can affect its behavior in chemical reactions and interactions with other molecules. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H9N3S
InChI:InChI=1S/C12H9N3S/c16-12-8-4-1-2-5-9(8)14-11-10(15-12)6-3-7-13-11/h1-7H,(H,13,14)(H,15,16)
InChI key:InChIKey=DAMKLONWIZWQBU-UHFFFAOYSA-N
SMILES:S=C1C=2C(NC=3C(N1)=CC=CN3)=CC=CC2
Synonyms:
  • 5,11-Dihydro-6H-pyrido[2,3-b][1,4]benzodiazepine-6-thione
  • 6H-Pyrido[2,3-b][1,4]benzodiazepine-6-thione, 5,11-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.