CAS 1204296-94-5
:3-(3-Fluorophenyl)-7-hydrazinyl-2,5-dimethylpyrazolo[1,5-a]pyrimidine
Description:
3-(3-Fluorophenyl)-7-hydrazinyl-2,5-dimethylpyrazolo[1,5-a]pyrimidine is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a hydrazine functional group, which is known for its reactivity and potential biological activity. The presence of a fluorophenyl group suggests that it may exhibit unique electronic properties, potentially influencing its interaction with biological targets. The dimethyl substitutions on the pyrazolo ring can affect the compound's solubility and stability. Generally, compounds of this type are of interest in medicinal chemistry due to their potential as pharmacological agents, particularly in the development of drugs targeting various diseases. The specific characteristics, such as melting point, solubility, and biological activity, would require empirical data from experimental studies. Overall, this compound represents a class of heterocyclic compounds that may have applications in drug discovery and development.
Formula:C14H14FN5
InChI:InChI=1S/C14H14FN5/c1-8-6-12(18-16)20-14(17-8)13(9(2)19-20)10-4-3-5-11(15)7-10/h3-7,18H,16H2,1-2H3
InChI key:InChIKey=WDKXRZYSIFVYAC-UHFFFAOYSA-N
SMILES:CC=1C(=C2N(C(NN)=CC(C)=N2)N1)C3=CC(F)=CC=C3
Synonyms:- Pyrazolo[1,5-a]pyrimidine, 3-(3-fluorophenyl)-7-hydrazinyl-2,5-dimethyl-
- 3-(3-Fluorophenyl)-7-hydrazinyl-2,5-dimethylpyrazolo[1,5-a]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.