CAS 1204296-98-9

3-(2,5-Dimethylphenyl)-2,7-dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid

Description:

3-(2,5-Dimethylphenyl)-2,7-dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of the 2,5-dimethylphenyl substituent enhances its lipophilicity, which may influence its solubility and biological activity. The methyl groups on the pyrazolo and pyrimidine rings can affect the compound's steric properties and electronic distribution, potentially impacting its interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods. Overall, the unique structural features of this compound suggest potential applications in drug development and other fields of chemistry.

Formula: C₁₇H₁₇N₃O₂

InChI: InChI=1S/C17H17N3O2/c1-9-5-6-10(2)13(7-9)15-11(3)19-20-12(4)14(17(21)22)8-18-16(15)20/h5-8H,1-4H3,(H,21,22)

InChI key: InChIKey=NABBFKQFNAVHOD-UHFFFAOYSA-N

SMILES: CC=1C(=C2N(C(C)=C(C(O)=O)C=N2)N1)C3=C(C)C=CC(C)=C3

Synonyms:

• 3-(2,5-Dimethylphenyl)-2,7-dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 3-(2,5-dimethylphenyl)-2,7-dimethyl-