CymitQuimica logo

CAS 1204297-11-9

:

1-Methyl-6-phenyl-2,3-piperazinedione

Description:
1-Methyl-6-phenyl-2,3-piperazinedione, identified by its CAS number 1204297-11-9, is a chemical compound characterized by a piperazine ring structure that is substituted with a methyl group and a phenyl group. This compound typically exhibits properties associated with piperazine derivatives, such as potential biological activity, which may include effects on the central nervous system or interactions with various receptors. The presence of the phenyl group can enhance lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the diketone functional groups in the piperazinedione structure may participate in various chemical reactions, including nucleophilic additions or cyclization reactions. While specific data on its solubility, melting point, or boiling point may vary, compounds of this class are often soluble in organic solvents. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. However, detailed studies would be necessary to fully elucidate its biological activity and therapeutic potential.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-13-9(7-12-10(14)11(13)15)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,12,14)
InChI key:InChIKey=IEAMZRRIWURUED-UHFFFAOYSA-N
SMILES:CN1C(CNC(=O)C1=O)C2=CC=CC=C2
Synonyms:
  • 1-Methyl-6-phenyl-2,3-piperazinedione
  • 2,3-Piperazinedione, 1-methyl-6-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.