CymitQuimica logo

CAS 1204297-15-3

:

1-[3-(3-Pyridinyl)-1,2,4-oxadiazol-5-yl]-2-propanone

Description:
1-[3-(3-Pyridinyl)-1,2,4-oxadiazol-5-yl]-2-propanone, identified by its CAS number 1204297-15-3, is a chemical compound characterized by its unique structural features, which include a pyridine ring and an oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for heterocyclic compounds. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. The pyridine group may enhance the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the ketone functional group (propanone) can participate in various chemical reactions, including nucleophilic additions. Overall, this compound's unique structure suggests potential applications in drug development and materials science, although specific biological activities and reactivity would require further investigation through experimental studies.
Formula:C10H9N3O2
InChI:InChI=1S/C10H9N3O2/c1-7(14)5-9-12-10(13-15-9)8-3-2-4-11-6-8/h2-4,6H,5H2,1H3
InChI key:InChIKey=YIIFTIDHRAXEAI-UHFFFAOYSA-N
SMILES:C(C(C)=O)C1=NC(=NO1)C=2C=CC=NC2
Synonyms:
  • 2-Propanone, 1-[3-(3-pyridinyl)-1,2,4-oxadiazol-5-yl]-
  • 1-[3-(3-Pyridinyl)-1,2,4-oxadiazol-5-yl]-2-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.