CymitQuimica logo

CAS 1204297-19-7

:

5-[(4-Fluorophenyl)methoxy]-1(2H)-isoquinolinethione

Description:
5-[(4-Fluorophenyl)methoxy]-1(2H)-isoquinolinethione is a chemical compound characterized by its unique structure, which includes an isoquinoline core substituted with a methoxy group and a fluorophenyl moiety. The presence of the thione functional group indicates that it contains a sulfur atom double-bonded to a carbon atom, which can influence its reactivity and potential biological activity. This compound may exhibit properties typical of isoquinoline derivatives, such as potential pharmacological effects, including antimicrobial or anticancer activities, due to the presence of the fluorophenyl group that can enhance lipophilicity and bioactivity. Additionally, the methoxy group can affect the compound's solubility and stability. The fluorine atom in the para position of the phenyl ring can also modify electronic properties, potentially impacting the compound's interaction with biological targets. Overall, this compound's characteristics suggest it may be of interest in medicinal chemistry and drug development, although specific biological activities would require empirical investigation.
Formula:C16H12FNOS
InChI:InChI=1S/C16H12FNOS/c17-12-6-4-11(5-7-12)10-19-15-3-1-2-14-13(15)8-9-18-16(14)20/h1-9H,10H2,(H,18,20)
InChI key:InChIKey=SYGZZRPLIXPTIY-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(F)C=C1)C2=C3C(C(=S)NC=C3)=CC=C2
Synonyms:
  • 5-[(4-Fluorophenyl)methoxy]-1(2H)-isoquinolinethione
  • 1(2H)-Isoquinolinethione, 5-[(4-fluorophenyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.