CAS 1204297-23-3

2,5-Dibromo-4-thiazolecarbonitrile

Description:

2,5-Dibromo-4-thiazolecarbonitrile is a heterocyclic organic compound characterized by the presence of both bromine atoms and a thiazole ring in its structure. The thiazole moiety contributes to its potential biological activity, as thiazoles are known for their role in various pharmacological applications. The compound features a carbonitrile functional group, which enhances its reactivity and solubility in polar solvents. Its dibromo substitution pattern can influence its electronic properties and reactivity, making it a candidate for various synthetic applications. Typically, compounds like this may exhibit antimicrobial, antifungal, or herbicidal properties, although specific biological activities would depend on further empirical studies. The presence of halogens, such as bromine, often increases the lipophilicity of the compound, potentially affecting its bioavailability and interaction with biological systems. Overall, 2,5-Dibromo-4-thiazolecarbonitrile is of interest in both synthetic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₄Br₂N₂S

InChI: InChI=1S/C4Br2N2S/c5-3-2(1-7)8-4(6)9-3

InChI key: InChIKey=MJFYQFOBKFEGNO-UHFFFAOYSA-N

SMILES: C(#N)C1=C(Br)SC(Br)=N1

Synonyms:

• 2,5-Dibromo-4-thiazolecarbonitrile
• 4-Thiazolecarbonitrile, 2,5-dibromo-