CymitQuimica logo

CAS 1204297-29-9

:

4,7-Dihydro-2-methyl-7-oxo-3-phenylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid

Description:
4,7-Dihydro-2-methyl-7-oxo-3-phenylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine framework. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of a phenyl group enhances its aromatic characteristics, which may influence its solubility and interaction with biological systems. The methyl and keto groups in the structure can affect its electronic properties and stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structural features suggest potential applications in drug design, where modifications could lead to enhanced efficacy or selectivity. As with many heterocycles, the compound's properties, such as melting point, solubility, and reactivity, would depend on the specific conditions and solvents used in experimentation. Further studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C14H11N3O3
InChI:InChI=1S/C14H11N3O3/c1-8-11(9-5-3-2-4-6-9)12-15-7-10(14(19)20)13(18)17(12)16-8/h2-7,15H,1H3,(H,19,20)
InChI key:InChIKey=XFVKRAAFWIJHKH-UHFFFAOYSA-N
SMILES:CC=1C(=C2N(C(=O)C(C(O)=O)=CN2)N1)C3=CC=CC=C3
Synonyms:
  • Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 4,7-dihydro-2-methyl-7-oxo-3-phenyl-
  • 4,7-Dihydro-2-methyl-7-oxo-3-phenylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.