CymitQuimica logo

CAS 1204297-43-7

:

6-(1-Piperazinyl)-3-(2-thienylmethyl)-1,2,4-triazolo[4,3-b]pyridazine

Description:
6-(1-Piperazinyl)-3-(2-thienylmethyl)-1,2,4-triazolo[4,3-b]pyridazine is a chemical compound characterized by its complex structure, which includes a triazolo-pyridazine core fused with a piperazine moiety and a thienylmethyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the piperazine ring suggests possible interactions with neurotransmitter receptors, while the thienylmethyl group may contribute to its pharmacological profile. The triazolo-pyridazine framework is known for its diverse biological activities, including antimicrobial and anti-inflammatory effects. Additionally, the compound's molecular structure may influence its stability, reactivity, and interaction with biological targets. Overall, this substance represents a class of compounds that could be explored for therapeutic applications, particularly in the fields of neuropharmacology and drug development. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C14H16N6S
InChI:InChI=1S/C14H16N6S/c1-2-11(21-9-1)10-14-17-16-12-3-4-13(18-20(12)14)19-7-5-15-6-8-19/h1-4,9,15H,5-8,10H2
InChI key:InChIKey=IXPQIIWMFSTVLY-UHFFFAOYSA-N
SMILES:C(C=1N2C(C=CC(=N2)N3CCNCC3)=NN1)C4=CC=CS4
Synonyms:
  • 1,2,4-Triazolo[4,3-b]pyridazine, 6-(1-piperazinyl)-3-(2-thienylmethyl)-
  • 6-(1-Piperazinyl)-3-(2-thienylmethyl)-1,2,4-triazolo[4,3-b]pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.