
CAS 1204297-48-2
:2-Bromo-5-chloro-4-thiazolecarboxamide
Description:
2-Bromo-5-chloro-4-thiazolecarboxamide is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of bromine and chlorine substituents on the thiazole ring enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit properties such as antimicrobial or antifungal activity, although specific biological data would be required to confirm these effects. Additionally, its solubility and stability in various solvents can vary, impacting its application in research and industry. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental concerns. Overall, 2-Bromo-5-chloro-4-thiazolecarboxamide represents a class of compounds that may have significant implications in pharmaceutical development and chemical synthesis.
Formula:C4H2BrClN2OS
InChI:InChI=1S/C4H2BrClN2OS/c5-4-8-1(3(7)9)2(6)10-4/h(H2,7,9)
InChI key:InChIKey=ZNCPSUAZPZFSBC-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1N=C(Br)SC1Cl
Synonyms:- 2-Bromo-5-chloro-4-thiazolecarboxamide
- 4-Thiazolecarboxamide, 2-bromo-5-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.