CAS 1204297-58-4

2-[[3-(2-Methoxyphenyl)-1,2,4-triazolo[4,3-b]pyridazin-6-yl]oxy]ethanamine

Description:

2-[[3-(2-Methoxyphenyl)-1,2,4-triazolo[4,3-b]pyridazin-6-yl]oxy]ethanamine is a chemical compound characterized by its complex structure, which includes a triazolo-pyridazine moiety and an ether linkage. This compound features a methoxyphenyl group, contributing to its potential aromatic properties and influencing its solubility and reactivity. The presence of the ethanamine functional group suggests that it may exhibit basic properties, allowing for interactions with various biological targets. The triazole ring is known for its role in medicinal chemistry, often associated with diverse pharmacological activities. The compound's specific stereochemistry, molecular weight, and functional groups can significantly affect its biological activity, making it a subject of interest in drug discovery and development. Additionally, its CAS number, 1204297-58-4, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in research and industry. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the field of chemistry.

Formula: C₁₄H₁₅N₅O₂

InChI: InChI=1S/C14H15N5O2/c1-20-11-5-3-2-4-10(11)14-17-16-12-6-7-13(18-19(12)14)21-9-8-15/h2-7H,8-9,15H2,1H3

InChI key: InChIKey=FJVZHJOGTXZTEX-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=2N3C(=NN2)C=CC(OCCN)=N3)C=CC=C1

Synonyms:

• Ethanamine, 2-[[3-(2-methoxyphenyl)-1,2,4-triazolo[4,3-b]pyridazin-6-yl]oxy]-
• 2-[[3-(2-Methoxyphenyl)-1,2,4-triazolo[4,3-b]pyridazin-6-yl]oxy]ethanamine