CAS 1204297-69-7

7-Chloro-3-(2,5-dimethylphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine

Description:

7-Chloro-3-(2,5-dimethylphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine core structure, which incorporates both pyrazole and pyrimidine rings. The presence of a chlorine atom at the 7-position and a 2,5-dimethylphenyl group at the 3-position contributes to its unique chemical properties and potential biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the presence of multiple methyl groups and aromatic systems, which can influence its solubility and permeability in biological systems. Additionally, the chlorine substituent may enhance its reactivity and interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including potential roles as anti-inflammatory, analgesic, or anticancer agents. The specific interactions and mechanisms of action would depend on further studies, including in vitro and in vivo evaluations. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₆H₁₆ClN₃

InChI: InChI=1S/C16H16ClN3/c1-9-5-6-10(2)13(7-9)15-12(4)19-20-14(17)8-11(3)18-16(15)20/h5-8H,1-4H3

InChI key: InChIKey=GQBCBUKUBFSNMD-UHFFFAOYSA-N

SMILES: CC=1C(=C2N(N1)C(Cl)=CC(C)=N2)C3=C(C)C=CC(C)=C3

Synonyms:

• 7-Chloro-3-(2,5-dimethylphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine
• Pyrazolo[1,5-a]pyrimidine, 7-chloro-3-(2,5-dimethylphenyl)-2,5-dimethyl-