CAS 1204297-72-2
:3-(3-Fluorophenyl)-2,7-dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Description:
3-(3-Fluorophenyl)-2,7-dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a fluorophenyl group, contributing to its potential biological activity and lipophilicity. The presence of the carboxylic acid functional group indicates that it can participate in hydrogen bonding and may exhibit acidic properties. The two methyl groups at the 2 and 7 positions of the pyrazolo ring enhance its steric bulk and may influence its solubility and reactivity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the pyrazolo-pyrimidine scaffold can lead to compounds with varied pharmacological profiles. Its CAS number, 1204297-72-2, allows for easy identification in chemical databases. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research in various chemical and biological contexts.
Formula:C15H12FN3O2
InChI:InChI=1S/C15H12FN3O2/c1-8-13(10-4-3-5-11(16)6-10)14-17-7-12(15(20)21)9(2)19(14)18-8/h3-7H,1-2H3,(H,20,21)
InChI key:InChIKey=YYTAOGNQWZGQJT-UHFFFAOYSA-N
SMILES:CC=1C(=C2N(N1)C(C)=C(C(O)=O)C=N2)C3=CC(F)=CC=C3
Synonyms:- Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 3-(3-fluorophenyl)-2,7-dimethyl-
- 3-(3-Fluorophenyl)-2,7-dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.