CAS 1204297-75-5

7-Chloro-3-(3-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine

Description:

7-Chloro-3-(3-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. The presence of chlorine and fluorine substituents contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their biological activities, including anti-inflammatory and anti-cancer properties. The presence of multiple methyl groups enhances its lipophilicity, which can affect its pharmacokinetics. Additionally, the specific arrangement of substituents may lead to interesting interactions with biological targets, making it a candidate for further research in drug discovery and development. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₄H₁₁ClFN₃

InChI: InChI=1S/C14H11ClFN3/c1-8-6-12(15)19-14(17-8)13(9(2)18-19)10-4-3-5-11(16)7-10/h3-7H,1-2H3

InChI key: InChIKey=AUAJOJOQMVZTIU-UHFFFAOYSA-N

SMILES: CC=1C(=C2N(C(Cl)=CC(C)=N2)N1)C3=CC(F)=CC=C3

Synonyms:

• 7-Chloro-3-(3-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine
• Pyrazolo[1,5-a]pyrimidine, 7-chloro-3-(3-fluorophenyl)-2,5-dimethyl-