CAS 1204297-77-7

7-Chloro-2,5-dimethyl-3-(3-methylphenyl)pyrazolo[1,5-a]pyrimidine

Description:

7-Chloro-2,5-dimethyl-3-(3-methylphenyl)pyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a chlorine atom at the 7-position and two methyl groups at the 2 and 5 positions of the pyrazolo ring, contributing to its lipophilicity and potential biological activity. The presence of a 3-methylphenyl group at the 3-position enhances its structural complexity and may influence its interaction with biological targets. The compound is likely to exhibit properties typical of heterocycles, such as moderate solubility in organic solvents and potential reactivity due to the presence of nitrogen atoms in its rings. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its pharmacological properties and potential uses.

Formula: C₁₅H₁₄ClN₃

InChI: InChI=1S/C15H14ClN3/c1-9-5-4-6-12(7-9)14-11(3)18-19-13(16)8-10(2)17-15(14)19/h4-8H,1-3H3

InChI key: InChIKey=MEKMWDDYOMQGNF-UHFFFAOYSA-N

SMILES: CC=1C(=C2N(C(Cl)=CC(C)=N2)N1)C3=CC(C)=CC=C3

Synonyms:

• Pyrazolo[1,5-a]pyrimidine, 7-chloro-2,5-dimethyl-3-(3-methylphenyl)-
• 7-Chloro-2,5-dimethyl-3-(3-methylphenyl)pyrazolo[1,5-a]pyrimidine