CAS 1204297-83-5

3,4-Dihydro-6-methoxy-2(1H)-isoquinolineethanethioamide

Description:

3,4-Dihydro-6-methoxy-2(1H)-isoquinolineethanethioamide is a chemical compound characterized by its isoquinoline structure, which features a bicyclic aromatic system. This compound contains a methoxy group, contributing to its potential solubility and reactivity. The presence of a thioamide functional group indicates that it may exhibit unique chemical properties, such as the ability to form hydrogen bonds and participate in nucleophilic reactions. The dihydro form suggests that there are two hydrogen atoms added to the isoquinoline ring, which can influence its stability and reactivity. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, the specific arrangement of functional groups may impart distinct pharmacological properties, making it a subject of interest for further research. However, detailed studies on its biological activity, toxicity, and potential applications would be necessary to fully understand its characteristics and utility in various fields.

Formula: C₁₂H₁₆N₂OS

InChI: InChI=1S/C12H16N2OS/c1-15-11-3-2-10-7-14(8-12(13)16)5-4-9(10)6-11/h2-3,6H,4-5,7-8H2,1H3,(H2,13,16)

InChI key: InChIKey=RXGPXMQOGZZVRF-UHFFFAOYSA-N

SMILES: C(C(N)=S)N1CC=2C(=CC(OC)=CC2)CC1

Synonyms:

• 2(1H)-Isoquinolineethanethioamide, 3,4-dihydro-6-methoxy-
• 3,4-Dihydro-6-methoxy-2(1H)-isoquinolineethanethioamide