CymitQuimica logo

CAS 1204297-85-7

:

2-Methyl-3-thiazolo[5,4-b]pyridin-2-ylbenzenamine

Description:
2-Methyl-3-thiazolo[5,4-b]pyridin-2-ylbenzenamine is a heterocyclic compound characterized by the presence of both thiazole and pyridine rings fused together, along with an aniline moiety. This compound features a methyl group at the 2-position of the thiazole ring, which can influence its electronic properties and reactivity. The thiazole and pyridine rings contribute to its potential biological activity, making it of interest in medicinal chemistry. The presence of the amino group (aniline) allows for hydrogen bonding and can enhance solubility in polar solvents. This compound may exhibit various properties such as fluorescence, depending on its molecular structure and substituents. Its unique arrangement of heteroatoms (sulfur and nitrogen) within the rings can also impart specific chemical reactivity, making it suitable for various synthetic applications. Overall, 2-Methyl-3-thiazolo[5,4-b]pyridin-2-ylbenzenamine is a complex organic molecule with potential applications in pharmaceuticals and materials science.
Formula:C13H11N3S
InChI:InChI=1S/C13H11N3S/c1-8-9(4-2-5-10(8)14)12-16-11-6-3-7-15-13(11)17-12/h2-7H,14H2,1H3
InChI key:InChIKey=SCKBFMKNVAQNSG-UHFFFAOYSA-N
SMILES:CC1=C(C2=NC=3C(S2)=NC=CC3)C=CC=C1N
Synonyms:
  • Benzenamine, 2-methyl-3-thiazolo[5,4-b]pyridin-2-yl-
  • 2-Methyl-3-thiazolo[5,4-b]pyridin-2-ylbenzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.