CAS 1204297-93-7

4-[[(Diethylamino)carbonyl]oxy]benzoic acid

Description:

4-[[(Diethylamino)carbonyl]oxy]benzoic acid, also known by its CAS number 1204297-93-7, is an organic compound characterized by its functional groups and structural features. It contains a benzoic acid moiety, which contributes to its acidity and potential for forming salts or esters. The presence of the diethylamino group suggests that it may exhibit basic properties, allowing for interactions with acids and other electrophiles. The carbonyl and ether functionalities indicate that it can participate in various chemical reactions, such as esterification or amidation. This compound may also display solubility in organic solvents due to its hydrophobic aromatic ring, while the carboxylic acid group can impart some degree of hydrophilicity. Its unique structure may lead to specific biological activities, making it of interest in pharmaceutical applications. Overall, the compound's characteristics, including its molecular structure, functional groups, and potential reactivity, make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₂H₁₅NO₄

InChI: InChI=1S/C12H15NO4/c1-3-13(4-2)12(16)17-10-7-5-9(6-8-10)11(14)15/h5-8H,3-4H2,1-2H3,(H,14,15)

InChI key: InChIKey=DGPAUSSMVIDYGO-UHFFFAOYSA-N

SMILES: O(C(N(CC)CC)=O)C1=CC=C(C(O)=O)C=C1

Synonyms:

• 4-[[(Diethylamino)carbonyl]oxy]benzoic acid
• Benzoic acid, 4-[[(diethylamino)carbonyl]oxy]-
• 4-[(Diethylcarbamoyl)oxy]benzoic acid

4-[(Diethylcarbamoyl)oxy]benzoic acid

CAS: 1204297-93-7

Formula: C₁₂H₁₅NO₄

Purity: 95.0%

Molecular weight: 237.255

Ref: 10-F495865