CymitQuimica logo

CAS 1204297-94-8

:

2-[2-(3-Pyridinyl)-4-thiazolyl]benzenamine

Description:
2-[2-(3-Pyridinyl)-4-thiazolyl]benzenamine, identified by its CAS number 1204297-94-8, is an organic compound characterized by its complex molecular structure, which includes a benzene ring, a pyridine moiety, and a thiazole group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of nitrogen and sulfur atoms in its structure may contribute to its reactivity and interaction with biological targets. Additionally, the compound may display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Its potential applications could include roles in drug development or as a chemical probe in biological research, although specific biological activities would depend on further empirical studies. Overall, the unique combination of functional groups in this compound suggests a diverse range of chemical behavior and potential utility in various fields of research.
Formula:C14H11N3S
InChI:InChI=1S/C14H11N3S/c15-12-6-2-1-5-11(12)13-9-18-14(17-13)10-4-3-7-16-8-10/h1-9H,15H2
InChI key:InChIKey=HVGCUQSUIBNJHH-UHFFFAOYSA-N
SMILES:NC1=C(C=CC=C1)C=2N=C(SC2)C=3C=CC=NC3
Synonyms:
  • 2-[2-(3-Pyridinyl)-4-thiazolyl]benzenamine
  • Benzenamine, 2-[2-(3-pyridinyl)-4-thiazolyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.