CAS 1204297-99-3

4-Chloro-6-(4-phenyl-1-piperazinyl)pyrimidine

Description:

4-Chloro-6-(4-phenyl-1-piperazinyl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at position 4 and a piperazine moiety substituted at position 6 contributes to its unique properties. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate due to its structural features, which may influence its biological activity. The piperazine ring, known for its role in various pharmacological agents, enhances the compound's interaction with biological targets, potentially affecting neurotransmitter systems. Its molecular structure suggests it may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Additionally, the presence of the phenyl group can influence lipophilicity, which is crucial for drug absorption and distribution. Overall, 4-Chloro-6-(4-phenyl-1-piperazinyl)pyrimidine is of interest in medicinal chemistry for its potential therapeutic applications.

Formula: C₁₄H₁₅ClN₄

InChI: InChI=1S/C14H15ClN4/c15-13-10-14(17-11-16-13)19-8-6-18(7-9-19)12-4-2-1-3-5-12/h1-5,10-11H,6-9H2

InChI key: InChIKey=DAHWQAPHKBOZFQ-UHFFFAOYSA-N

SMILES: ClC1=CC(=NC=N1)N2CCN(CC2)C3=CC=CC=C3

Synonyms:

• 4-Chloro-6-(4-phenyl-1-piperazinyl)pyrimidine
• Pyrimidine, 4-chloro-6-(4-phenyl-1-piperazinyl)-