CAS 1204298-23-6: 3-(1,3-Benzodioxol-5-yl)-5-(chloromethyl)-2-oxazolidinone

Description: 3-(1,3-Benzodioxol-5-yl)-5-(chloromethyl)-2-oxazolidinone is a synthetic organic compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of the benzodioxole moiety contributes to its aromatic properties, potentially influencing its reactivity and interaction with biological systems. The chloromethyl group enhances its electrophilic character, making it a candidate for further chemical modifications or reactions. This compound may exhibit interesting pharmacological properties, as oxazolidinones are known for their antibacterial activity, particularly in the context of drug development. Its molecular structure suggests potential applications in medicinal chemistry, though specific biological activities would require empirical investigation. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, which are critical for understanding its behavior in various chemical environments. Safety and handling considerations are essential, as with any chlorinated compound, due to potential toxicity and environmental impact.

Formula: C₁₁H₁₀ClNO₄

InChI: InChI=1S/C11H10ClNO4/c12-4-8-5-13(11(14)17-8)7-1-2-9-10(3-7)16-6-15-9/h1-3,8H,4-6H2

InChI key: InChIKey=BKYVFTGFXIPMCE-UHFFFAOYSA-N

SMILES: O=C1OC(CCl)CN1C2=CC=C3OCOC3=C2

Synonyms:

• 3-(1,3-Benzodioxol-5-yl)-5-(chloromethyl)-2-oxazolidinone
• 2-Oxazolidinone, 3-(1,3-benzodioxol-5-yl)-5-(chloromethyl)-

3-(1,3-Dioxaindan-5-yl)-5-(chloromethyl)-1,3-oxazolidin-2-one

CAS: 1204298-23-6

Versatile small molecule scaffold

• Formula: C₁₁H₁₀ClNO₄
• Purity: Min. 95%
• Molecular weight: 255.65 g/mol

3-(Benzo[d][1,3]dioxol-5-yl)-5-(chloromethyl)oxazolidin-2-one

CAS: 1204298-23-6

• Purity: 98%
• Molecular weight: 255.64999389648438