
CAS 1204298-27-0
:5-Bromo-2-chloro-4-thiazolecarbonitrile
Description:
5-Bromo-2-chloro-4-thiazolecarbonitrile is a heterocyclic compound characterized by the presence of both bromine and chlorine substituents on a thiazole ring, along with a cyano group. This compound features a five-membered aromatic ring containing sulfur and nitrogen, which contributes to its unique chemical properties. The presence of the bromine and chlorine atoms enhances its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and agrochemicals. The cyano group (-CN) is known for its ability to participate in nucleophilic reactions, further expanding its utility in organic synthesis. Additionally, the compound may exhibit biological activity, making it a candidate for research in pharmacology. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and solvents used. Overall, 5-Bromo-2-chloro-4-thiazolecarbonitrile is a versatile compound with potential applications in various fields of chemistry.
Formula:C4BrClN2S
InChI:InChI=1S/C4BrClN2S/c5-3-2(1-7)8-4(6)9-3
InChI key:InChIKey=JBESZAHZHHQOLT-UHFFFAOYSA-N
SMILES:C(#N)C1=C(Br)SC(Cl)=N1
Synonyms:- 4-Thiazolecarbonitrile, 5-bromo-2-chloro-
- 5-Bromo-2-chloro-4-thiazolecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.