CAS 1204298-72-5

7-(Difluoromethyl)-1H-indazole

Description:

7-(Difluoromethyl)-1H-indazole is a chemical compound characterized by its indazole core, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of a difluoromethyl group at the 7-position introduces unique electronic and steric properties, making it of interest in medicinal chemistry and material science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential reactivity due to the presence of the difluoromethyl group, which can influence its interactions with biological targets or other chemical species. The compound's CAS number, 1204298-72-5, allows for precise identification in chemical databases and literature. As with many indazole derivatives, it may possess biological activity, making it a candidate for further research in pharmacology. Safety data and handling precautions should be consulted, as the presence of fluorine atoms can affect toxicity and environmental impact. Overall, 7-(Difluoromethyl)-1H-indazole represents a compound of interest for further exploration in various scientific fields.

Formula: C₈H₆F₂N₂

InChI: InChI=1S/C8H6F2N2/c9-8(10)6-3-1-2-5-4-11-12-7(5)6/h1-4,8H,(H,11,12)

InChI key: InChIKey=PNONXQVUKSQIHV-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C2C(C=NN2)=CC=C1

Synonyms:

• 1H-Indazole, 7-(difluoromethyl)-
• 7-(Difluoromethyl)-1H-indazole