CAS 1204298-76-9: 6-(Difluoromethyl)-2,3-dihydro-2-thioxo-4(1H)-pyrimidinone
Description:6-(Difluoromethyl)-2,3-dihydro-2-thioxo-4(1H)-pyrimidinone is a heterocyclic compound characterized by its pyrimidinone core, which features a thioxo group and a difluoromethyl substituent. This compound typically exhibits a molecular structure that includes a six-membered ring containing nitrogen and sulfur atoms, contributing to its unique chemical properties. The difluoromethyl group enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The thioxo group can participate in various chemical reactions, potentially leading to the formation of derivatives with diverse functionalities. Additionally, the compound's polar nature may affect its solubility and interaction with biological systems. Its specific applications can vary, but it may be explored for use in pharmaceuticals or agrochemicals due to its structural features. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental factors such as pH and temperature. Overall, 6-(Difluoromethyl)-2,3-dihydro-2-thioxo-4(1H)-pyrimidinone represents a class of compounds with potential utility in various chemical and biological applications.
Formula:C5H4F2N2OS
InChI:InChI=1S/C5H4F2N2OS/c6-4(7)2-1-3(10)9-5(11)8-2/h1,4H,(H2,8,9,10,11)
InChI key:InChIKey=RPFVUMOHGFOCGJ-UHFFFAOYSA-N
SMILES:O=C1C=C(NC(=S)N1)C(F)F
- Synonyms:
- 4(1H)-Pyrimidinone, 6-(difluoromethyl)-2,3-dihydro-2-thioxo-
- 4-Hydroxy-2-thio-6-(difluoromethyl)pyrimidine
- 6-(Difluoromethyl)-2,3-dihydro-2-thioxo-4(1H)-pyrimidinone
- 6-(Difluoromethyl)-2-mercaptopyrimidin-4-ol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-(difluoromethyl)-2-sulfanylidene-1,2,3,4-tetrahydropyrimidin-4-one REF: 10-F521164CAS: 1204298-76-9 | 95.0% | To inquire | Mon 07 Apr 25 |
![]() | 6-(Difluoromethyl)-2-sulfanylpyrimidin-4-ol REF: 3D-EYB29876CAS: 1204298-76-9 | Min. 95% | To inquire | Wed 07 May 25 |

6-(difluoromethyl)-2-sulfanylidene-1,2,3,4-tetrahydropyrimidin-4-one
Ref: 10-F521164
1g | To inquire | ||
2.5g | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

6-(Difluoromethyl)-2-sulfanylpyrimidin-4-ol
Ref: 3D-EYB29876
2500mg | 517.00 € |