CAS 1204313-58-5

4-Chloro-7,8,10,11,13,14-hexahydro[1,4,7,10]tetraoxacyclododecino[2,3-g]quinazoline

Description:

4-Chloro-7,8,10,11,13,14-hexahydro[1,4,7,10]tetraoxacyclododecino[2,3-g]quinazoline is a complex organic compound characterized by its unique bicyclic structure, which incorporates multiple oxygen atoms within its framework. The presence of the chloro substituent indicates that it has halogenated properties, which can influence its reactivity and solubility. This compound features a quinazoline core, a structure known for its biological activity, including potential pharmacological applications. The tetraoxacyclododecino moiety suggests that it may exhibit interesting conformational properties due to the cyclic nature of the molecule. Its hexahydro configuration implies that it is saturated, which may enhance its stability compared to unsaturated analogs. The specific arrangement of functional groups and the presence of heteroatoms contribute to its potential interactions in biological systems, making it a candidate for further research in medicinal chemistry. Overall, this compound's intricate structure and functional characteristics may lead to diverse applications in drug development and other fields of chemistry.

Formula: C₁₄H₁₅ClN₂O₄

InChI: InChI=1S/C14H15ClN2O4/c15-14-10-7-12-13(8-11(10)16-9-17-14)21-6-4-19-2-1-18-3-5-20-12/h7-9H,1-6H2

InChI key: InChIKey=BUXRNECOVLCHCM-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=C3C(=C2)OCCOCCOCCO3)N=CN1

Synonyms:

• [1,4,7,10]Tetraoxacyclododecino[2,3-g]quinazoline, 4-chloro-7,8,10,11,13,14-hexahydro-
• 4-Chloro-7,8,10,11,13,14-hexahydro[1,4,7,10]tetraoxacyclododecino[2,3-g]quinazoline

4-chloro-7H,8H,10H,11H,13H,14H-1,4,7,10-tetraoxacyclododeca[2,3-g]quinazoline

CAS: 1204313-58-5

Formula: C₁₄H₁₅ClN₂O₄

Purity: 97%

Molecular weight: 310.7329

Ref: IN-DA00IL7E

Icotinib Impurity 4

CAS: 1204313-58-5

Formula: C₁₄H₁₅ClN₂O₄

Molecular weight: 310.73

Ref: ST-EA-CP-I56002