CAS 1204333-48-1

1H-Indole, 7-bromo-1,2-dimethyl-

Description:

1H-Indole, 7-bromo-1,2-dimethyl- is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of bromine at the 7-position and two methyl groups at the 1 and 2 positions contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, and materials science due to the indole moiety's biological significance and the influence of the bromine and methyl substituents on its chemical behavior. Additionally, the compound may participate in various chemical reactions, including electrophilic substitutions and cross-coupling reactions, making it of interest in synthetic organic chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific hazards.

Formula: C₁₀H₁₀BrN

InChI: InChI=1S/C10H10BrN/c1-7-6-8-4-3-5-9(11)10(8)12(7)2/h3-6H,1-2H3

InChI key: InChIKey=ZBGRTVIIKMKLKC-UHFFFAOYSA-N

SMILES: CN1C=2C(C=C1C)=CC=CC2Br

Synonyms:

• 1H-Indole, 7-bromo-1,2-dimethyl-
• 7-Bromo-1,2-dimethyl-1H-indole