CAS 120436-02-4
:2-AMINO-N-CYCLOPROPYL-ACETAMIDE
Description:
2-Amino-N-cyclopropyl-acetamide is an organic compound characterized by its amine and amide functional groups. It features a cyclopropyl group, which is a three-membered carbon ring, attached to the nitrogen atom of the amide. This structure contributes to its unique chemical properties, including potential steric effects and reactivity. The presence of the amino group indicates that it can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The compound is typically a white to off-white solid and is soluble in polar solvents due to its polar functional groups. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. As with many amides, it may also be involved in various chemical reactions, such as acylation or amidation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C5H10N2O
InChI:InChI=1/C5H10N2O/c6-3-5(8)7-4-1-2-4/h4H,1-3,6H2,(H,7,8)
SMILES:C1CC1N=C(CN)O
Synonyms:- 2-amino-N-cyclopropylacetamide
- N-cyclopropylglycinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
