CAS 120444-24-8
:3-F-INS
Description:
3-F-INS, or 3-fluoro-1H-indole-5-sulfonamide, is a chemical compound characterized by the presence of a fluorine atom attached to the indole ring structure, along with a sulfonamide functional group. This compound typically exhibits properties associated with both indole derivatives and sulfonamides, such as potential biological activity and solubility in polar solvents. The fluorine substitution can influence the compound's reactivity, stability, and interaction with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the sulfonamide group may impart antibacterial properties, which is a common characteristic of many sulfonamide-containing compounds. The compound's specific applications and behavior in various chemical environments would depend on its structural features and the presence of functional groups, which can affect its pharmacokinetics and pharmacodynamics. As with any chemical substance, safety data and handling precautions should be considered, particularly in laboratory or industrial settings.
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6,8-12H/t1?,2-,3-,4-,5+,6?/m1/s1
Synonyms:- 3-Deoxy-3-Fluoro-D-Myo-Inositol
- D-Myo-Inositol, 3-Deoxy-3-Fluoro-
- 3-Deoxy-3-Fluoroinositol
- (1S,2R,4S,5S)-6-fluorocyclohexane-1,2,3,4,5-pentol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Deoxy-3-fluoro-D-myo-inositol
CAS:Controlled ProductFormula:C6H11FO5Color and Shape:NeatMolecular weight:182.153-Deoxy-3-fluoro-D-myo-inositol
CAS:3-Deoxy-3-fluoro-D-myo-inositol, also known as myo-inositol 3-O-(2'-deoxy) (dFMI), is a natural product found in the brain that has been shown to selectively inhibit the growth of trophozoites. It can bind to nonselective cations and block intracellular Ca2+ channels. This causes an increase in cytosolic Ca2+ concentration, which activates a cytosolic Ca2+ signal cascade. These effects show that dFMI is capable of inhibiting the growth of trophozoites by blocking the function of Ca2+ channels and increasing cytosolic Ca2+.
Formula:C6H11FO5Purity:Min. 95%Molecular weight:182.15 g/mol

