CAS 1204475-66-0

3-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid

Description:

3-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. The presence of a bromine atom at the 3-position of the pyrrole ring contributes to its reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 2-position enhances its solubility in polar solvents and allows for potential derivatization, making it a versatile building block in organic synthesis. This compound may exhibit biological activity, which is often explored in drug discovery, particularly in the development of pharmaceuticals targeting various diseases. Its molecular structure suggests potential interactions with biological targets, and the bromine substituent may influence its pharmacokinetic properties. As with many heterocycles, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and methods used for synthesis and purification. Overall, 3-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid represents an interesting compound for further research and application in chemical and pharmaceutical sciences.

Formula: C₈H₅BrN₂O₂

InChI: InChI=1S/C8H5BrN2O2/c9-5-4-2-1-3-10-7(4)11-6(5)8(12)13/h1-3H,(H,10,11)(H,12,13)

InChI key: InChIKey=PEELKIVPKMVOHC-UHFFFAOYSA-N

SMILES: BrC=1C=2C(NC1C(O)=O)=NC=CC2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 3-bromo-
• 3-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid