
CAS 1204475-80-8
:3-(Carboxymethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
Description:
3-(Carboxymethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine structures, which contribute to its unique chemical properties. This compound features two carboxylic acid functional groups, which enhance its solubility in polar solvents and increase its acidity. The presence of the carboxymethyl group provides additional functional versatility, allowing for potential interactions in biochemical applications. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound may exhibit interesting biological activities, although specific studies would be necessary to elucidate its pharmacological profile. Additionally, its stability and reactivity can be influenced by the pH of the environment, making it relevant in various chemical and biological contexts. Overall, 3-(Carboxymethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid represents a valuable compound for research and development in organic and medicinal chemistry.
Formula:C10H8N2O4
InChI:InChI=1S/C10H8N2O4/c13-7(14)4-6-5-2-1-3-11-9(5)12-8(6)10(15)16/h1-3H,4H2,(H,11,12)(H,13,14)(H,15,16)
InChI key:InChIKey=PVLGWDPYEMMUPA-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(NC1C(O)=O)=NC=CC2
Synonyms:- 3-(Carboxymethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
- 2-Carboxy-1H-pyrrolo[2,3-b]pyridine-3-acetic acid
- 1H-Pyrrolo[2,3-b]pyridine-3-acetic acid, 2-carboxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.