CAS 1204475-86-4

1H-Pyrrolo[2,3-b]pyridine-2,3-dicarboxylic acid

Description:

1H-Pyrrolo[2,3-b]pyridine-2,3-dicarboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two carboxylic acid functional groups, which enhance its solubility in polar solvents and increase its potential for hydrogen bonding. The presence of these functional groups also suggests that it may exhibit acidic behavior, making it relevant in various chemical reactions, including esterification and amidation. Its structural configuration allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrole and pyridine derivatives. Additionally, the compound may exhibit interesting electronic properties owing to the conjugated system formed by the fused rings, which could be explored in materials science. Overall, 1H-Pyrrolo[2,3-b]pyridine-2,3-dicarboxylic acid is a versatile compound with potential applications across various fields, including organic synthesis and drug development.

Formula: C₉H₆N₂O₄

InChI: InChI=1S/C9H6N2O4/c12-8(13)5-4-2-1-3-10-7(4)11-6(5)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15)

InChI key: InChIKey=JAUCWBBRMXGDBE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1C(O)=O)=NC=CC2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-2,3-dicarboxylic acid