CymitQuimica logo

CAS 120456-32-8

:

5-ACETYL-2-HYDROXY-4-METHYLTHIOPHENE-3-CARBONITRILE

Description:
5-Acetyl-2-hydroxy-4-methylthiophene-3-carbonitrile is a heterocyclic organic compound characterized by its thiophene ring, which is a five-membered aromatic ring containing sulfur. This compound features an acetyl group and a hydroxyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of a carbonitrile group indicates that it contains a cyano functional group, which can enhance its polarity and reactivity, making it useful in various chemical reactions, including nucleophilic additions and as a building block in the synthesis of more complex molecules. The methylthio group adds to its structural diversity and can influence its electronic properties. This compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its specific physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. Overall, 5-acetyl-2-hydroxy-4-methylthiophene-3-carbonitrile is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C8H7NO2S
InChI:InChI=1/C8H7NO2S/c1-4-6(3-9)8(11)12-7(4)5(2)10/h11H,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.