CymitQuimica logo

CAS 1204580-84-6

:

5-(Phenylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxole

Description:
5-(Phenylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxole is a complex organic compound characterized by its unique structural features, which include a benzodioxole core and a boron-containing moiety. The presence of the phenylmethoxy group contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The dioxaborolane structure is notable for its ability to participate in various chemical reactions, including cross-coupling reactions, making it valuable in synthetic chemistry. This compound may exhibit specific physical properties such as solubility in organic solvents and stability under certain conditions, which are essential for its application in laboratory settings. Additionally, its molecular structure suggests potential interactions with biological systems, warranting further investigation into its biological activity and safety profile. Overall, this compound represents an interesting subject for research in both synthetic and medicinal chemistry due to its functional groups and potential reactivity.
Formula:C20H23BO5
InChI:InChI=1S/C20H23BO5/c1-19(2)20(3,4)26-21(25-19)17-15(10-11-16-18(17)24-13-23-16)22-12-14-8-6-5-7-9-14/h5-11H,12-13H2,1-4H3
InChI key:InChIKey=ZVGKVNLVAZCTPY-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C(=C3C(=CC2)OCO3)B4OC(C)(C)C(C)(C)O4
Synonyms:
  • 1,3-Benzodioxole, 5-(phenylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 5-(Phenylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.