CymitQuimica logo

CAS 1204580-86-8

:

2-[2-(Cyclobutylmethoxy)-6-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[2-(Cyclobutylmethoxy)-6-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a complex aromatic substituent. The presence of the dioxaborolane moiety suggests potential applications in organic synthesis, particularly in cross-coupling reactions, where boron compounds are often utilized as intermediates. The cyclobutylmethoxy and methoxy groups contribute to the compound's lipophilicity and may influence its reactivity and solubility in organic solvents. This compound may exhibit interesting electronic properties due to the conjugation between the aromatic system and the boron atom, potentially making it useful in materials science or medicinal chemistry. Additionally, the steric bulk provided by the tetramethyl groups can affect the compound's stability and reactivity. Overall, this compound's unique structure and functional groups position it as a potentially valuable entity in various chemical applications, although specific reactivity and properties would require empirical investigation.
Formula:C18H27BO4
InChI:InChI=1S/C18H27BO4/c1-17(2)18(3,4)23-19(22-17)16-14(20-5)10-7-11-15(16)21-12-13-8-6-9-13/h7,10-11,13H,6,8-9,12H2,1-5H3
InChI key:InChIKey=DWMOBGHHUVYDIW-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C2=C(B3OC(C)(C)C(C)(C)O3)C(OC)=CC=C2
Synonyms:
  • 1,3,2-Dioxaborolane, 2-[2-(cyclobutylmethoxy)-6-methoxyphenyl]-4,4,5,5-tetramethyl-
  • 2-[2-(Cyclobutylmethoxy)-6-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 2-Cyclobutylmethoxy-6-methoxyphenylboronic acid pinacol ester - C5453
  • 2-CyclobutylMethoxy-6-Methoxyphenylboronic acid pinacol ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.