
CAS 1204742-79-9
:N-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-7-yl]methanesulfonamide
Description:
N-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-7-yl]methanesulfonamide is a chemical compound characterized by its unique structure, which includes an indole moiety and a boron-containing dioxaborolane group. This compound is notable for its potential applications in medicinal chemistry, particularly in drug development, due to the presence of the sulfonamide functional group, which is known for its biological activity. The dioxaborolane unit may enhance the compound's stability and solubility, while also facilitating interactions with biological targets. The presence of the tetramethyl groups contributes to the compound's steric bulk, which can influence its reactivity and binding properties. Additionally, the indole ring is a common scaffold in pharmaceuticals, often associated with various biological activities, including anti-cancer and anti-inflammatory effects. Overall, this compound exemplifies the integration of diverse functional groups to create molecules with potential therapeutic applications.
Formula:C15H21BN2O4S
InChI:InChI=1S/C15H21BN2O4S/c1-14(2)15(3,4)22-16(21-14)11-8-10-6-7-17-13(10)12(9-11)18-23(5,19)20/h6-9,17-18H,1-5H3
InChI key:InChIKey=CJFVCKBEECVVDL-UHFFFAOYSA-N
SMILES:N(S(C)(=O)=O)C=1C=C(C=C2C1NC=C2)B3OC(C)(C)C(C)(C)O3
Synonyms:- Methanesulfonamide, N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-7-yl]-
- N-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-7-yl]methanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-indol-7-yl)methanesulfonamide
CAS:Formula:C15H21BN2O4SMolecular weight:336.2142
