CAS 1204765-85-4

1,2,3,4-Tetrahydro-8-isoquinolinemethanol

Description:

1,2,3,4-Tetrahydro-8-isoquinolinemethanol is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound consisting of a benzene ring fused to a pyridine ring. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the isoquinoline framework, resulting in a saturated structure. The presence of a hydroxymethyl group (-CH2OH) at the 8-position contributes to its reactivity and potential biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for interactions with biological targets, potentially influencing neurotransmitter systems or other physiological pathways. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, and it may undergo various chemical reactions typical of alcohols and amines. As with many organic compounds, its characteristics can be further explored through techniques such as spectroscopy and chromatography to determine purity and structural integrity.

Formula: C₁₀H₁₃NO

InChI: InChI=1S/C10H13NO/c12-7-9-3-1-2-8-4-5-11-6-10(8)9/h1-3,11-12H,4-7H2

InChI key: InChIKey=AHQDKYSHQFRJQO-UHFFFAOYSA-N

SMILES: C(O)C1=C2C(=CC=C1)CCNC2

Synonyms:

• 1,2,3,4-Tetrahydroisoquinolin-8-ylmethanol
• 1,2,3,4-Tetrahydro-8-isoquinolinemethanol
• (1,2,3,4-Tetrahydroisoquinolin-8-yl)methanol
• 8-Isoquinolinemethanol, 1,2,3,4-tetrahydro-