
CAS 12048-50-9
:Bismuth oxide (Bi2O4)
Description:
Bismuth oxide (Bi2O4) is a chemical compound characterized by its distinct properties and applications. It typically appears as a yellowish or white powder and is known for its high stability and low toxicity compared to other bismuth compounds. Bismuth oxide exhibits semiconductor behavior and has a relatively high melting point, making it suitable for various industrial applications. It is often utilized in the production of ceramics, glass, and as a catalyst in chemical reactions. Additionally, Bi2O4 has potential uses in electronics and optoelectronics due to its unique electronic properties. The compound is also recognized for its ability to absorb ultraviolet light, which enhances its utility in certain coatings and materials. Bismuth oxide can be synthesized through various methods, including thermal decomposition of bismuth salts or direct oxidation of bismuth metal. Its chemical stability and non-toxic nature make it an attractive alternative in applications where lead-based materials are traditionally used. Overall, bismuth oxide is a versatile compound with significant relevance in both industrial and research settings.
Formula:Bi2O4
InChI:InChI=1S/2Bi.4O
InChI key:InChIKey=FKEROWXJVRBJRF-UHFFFAOYSA-N
SMILES:O([Bi](=O)=O)[Bi]=O
Synonyms:- Bismuth oxide (Bi2O4)
- Bismuth dioxide
- Bismuth tetroxide
- Bismuth oxide (BiO2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
