CAS 1204809-96-0
:6-Phenyl-3-pyridineacetonitrile
Description:
6-Phenyl-3-pyridineacetonitrile, identified by its CAS number 1204809-96-0, is an organic compound characterized by its unique structure, which includes a pyridine ring and a phenyl group. This compound typically exhibits properties associated with both aromatic and nitrile functionalities. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of the polar nitrile group. The compound may display interesting reactivity patterns, particularly in nucleophilic substitution reactions, owing to the electron-withdrawing nature of the nitrile group. Additionally, its aromatic components can contribute to stability and potential interactions in various chemical environments. Applications may include use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development. Safety data should be consulted to understand any potential hazards associated with handling this compound.
Formula:C13H10N2
InChI:InChI=1S/C13H10N2/c14-9-8-11-6-7-13(15-10-11)12-4-2-1-3-5-12/h1-7,10H,8H2
InChI key:InChIKey=VZBFHKGVEZVALH-UHFFFAOYSA-N
SMILES:C(C#N)C1=CC=C(N=C1)C2=CC=CC=C2
Synonyms:- 6-Phenyl-3-pyridineacetonitrile
- 3-Pyridineacetonitrile, 6-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
