CymitQuimica logo

CAS 1204810-12-7

:

3-Bromo-4,6-dichloro-8-methoxyquinoline

Description:
3-Bromo-4,6-dichloro-8-methoxyquinoline is a synthetic organic compound belonging to the quinoline family, characterized by its complex aromatic structure. This compound features multiple halogen substituents, specifically bromine and chlorine, which can significantly influence its chemical reactivity and biological activity. The presence of a methoxy group enhances its solubility in organic solvents and may affect its interaction with biological targets. Typically, compounds like this are studied for their potential pharmacological properties, including antimicrobial or anticancer activities, due to the presence of the quinoline core, which is known for its diverse biological effects. The molecular structure suggests that it may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, depending on the conditions. Additionally, the compound's stability, melting point, and solubility can vary based on its environment and the presence of other substances. Overall, 3-Bromo-4,6-dichloro-8-methoxyquinoline represents a class of compounds with significant potential in medicinal chemistry and material science.
Formula:C10H6BrCl2NO
InChI:InChI=1S/C10H6BrCl2NO/c1-15-8-3-5(12)2-6-9(13)7(11)4-14-10(6)8/h2-4H,1H3
InChI key:InChIKey=ASTQHQXXOYSHDN-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C=C(Cl)C1)C(Cl)=C(Br)C=N2
Synonyms:
  • 3-Bromo-4,6-dichloro-8-methoxyquinoline
  • Quinoline, 3-bromo-4,6-dichloro-8-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.