CAS 1204810-30-9

3-Bromo-6,7-dichloro-4-quinolinol

Description:

3-Bromo-6,7-dichloro-4-quinolinol is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a bromine atom at the 3-position and two chlorine atoms at the 6 and 7 positions, along with a hydroxyl group (-OH) at the 4-position, contributing to its reactivity and potential biological activity. The presence of halogen substituents often enhances the compound's lipophilicity and can influence its interaction with biological targets. 3-Bromo-6,7-dichloro-4-quinolinol may exhibit antimicrobial or antiprotozoal properties, making it of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with altered pharmacological profiles. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential, particularly in the context of its potential applications in pharmaceuticals or agrochemicals. Proper handling and safety measures should be observed due to the presence of halogens and the compound's potential bioactivity.

Formula: C₉H₄BrCl₂NO

InChI: InChI=1S/C9H4BrCl2NO/c10-5-3-13-8-2-7(12)6(11)1-4(8)9(5)14/h1-3H,(H,13,14)

InChI key: InChIKey=RBECMAOZDWNJDH-UHFFFAOYSA-N

SMILES: OC=1C2=C(C=C(Cl)C(Cl)=C2)N=CC1Br

Synonyms:

• 3-Bromo-6,7-dichloro-4-quinolinol
• 4-Quinolinol, 3-bromo-6,7-dichloro-