CAS 1204810-57-0: Quinoline, 3,4-dichloro-7-methoxy-
Description:Quinoline, 3,4-dichloro-7-methoxy- is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure composed of a benzene ring fused to a pyridine ring. This specific derivative features two chlorine atoms and a methoxy group attached to the quinoline framework, which can influence its chemical reactivity and biological activity. The presence of the chlorine substituents typically enhances the compound's lipophilicity and may affect its interaction with biological targets, making it of interest in medicinal chemistry. The methoxy group can also contribute to the compound's solubility and stability. Quinoline derivatives are known for their diverse applications, including use as pharmaceuticals, agrochemicals, and in dye synthesis. The compound's unique structural features may impart specific properties, such as fluorescence or antimicrobial activity, depending on the context of its use. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C10H7Cl2NO
InChI:InChI=1S/C10H7Cl2NO/c1-14-6-2-3-7-9(4-6)13-5-8(11)10(7)12/h2-5H,1H3
InChI key:InChIKey=UJIHLIZYHGVCSR-UHFFFAOYSA-N
SMILES:ClC1=CN=C2C=C(OC)C=CC2=C1Cl
- Synonyms:
- 3,4-Dichloro-7-methoxyquinoline
- Quinoline, 3,4-dichloro-7-methoxy-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3,4-Dichloro-7-methoxyquinoline REF: 54-OR309333CAS: 1204810-57-0 | - - - | 450.00 € | Mon 10 Mar 25 |
![]() | 3,4-Dichloro-7-methoxyquinoline REF: 10-F734783CAS: 1204810-57-0 | 95+% | - - - | Discontinued product |
![]() | 3,4-Dichloro-7-methoxyquinoline REF: 3D-EYB81057CAS: 1204810-57-0 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 54-OR309333
1g | 450.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 10-F734783
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3,4-Dichloro-7-methoxyquinoline
Ref: 3D-EYB81057
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |