CAS 1204810-93-4: 3-Bromo-4-chloro-6-fluoroquinoline
Description:3-Bromo-4-chloro-6-fluoroquinoline is a heterocyclic organic compound belonging to the quinoline family, characterized by its fused aromatic rings and the presence of halogen substituents. The compound features a bromine atom at the 3-position, a chlorine atom at the 4-position, and a fluorine atom at the 6-position of the quinoline ring system. These halogen substitutions can significantly influence the compound's chemical reactivity, solubility, and biological activity. Typically, compounds like this may exhibit antimicrobial, antiviral, or anticancer properties, making them of interest in pharmaceutical research. The presence of multiple halogens can also enhance lipophilicity, affecting the compound's pharmacokinetics. Additionally, 3-Bromo-4-chloro-6-fluoroquinoline may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the electrophilic nature of the halogenated positions. Its unique structure and properties make it a valuable compound for further studies in medicinal chemistry and material science.
Formula:C9H4BrClFN
InChI:InChI=1S/C9H4BrClFN/c10-7-4-13-8-2-1-5(12)3-6(8)9(7)11/h1-4H
InChI key:InChIKey=NYHQVBUXWYXYLI-UHFFFAOYSA-N
SMILES:FC=1C=CC2=NC=C(Br)C(Cl)=C2C1
- Synonyms:
- 3-Bromo-4-chloro-6-fluoroquinoline
- Quinoline, 3-bromo-4-chloro-6-fluoro-
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-Bromo-4-chloro-6-fluoroquinoline
Ref: IN-DA00935I
1g | 108.00 € | ||
5g | 501.00 € | ||
100mg | 36.00 € | ||
250mg | 59.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 54-PC404594
1g | 535.00 € | ||
100mg | 134.00 € | ||
250mg | 213.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 10-F732129
1g | 80.00 € | ||
10g | 629.00 € | ||
100mg | 25.00 € | ||
250mg | 40.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-Bromo-4-chloro-6-fluoroquinoline
Ref: 3D-EYB81093
2500mg | 471.00 € |