CymitQuimica logo

CAS 1204811-48-2

:

3-Bromo-4-chloro-6-(trifluoromethoxy)quinoline

Description:
3-Bromo-4-chloro-6-(trifluoromethoxy)quinoline is a synthetic organic compound belonging to the quinoline family, characterized by its heterocyclic structure that includes a fused benzene and pyridine ring. This compound features a bromine atom at the 3-position, a chlorine atom at the 4-position, and a trifluoromethoxy group at the 6-position, which significantly influences its chemical reactivity and physical properties. The presence of halogen substituents typically enhances the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. The trifluoromethoxy group is particularly notable for its electron-withdrawing properties, which can stabilize certain reactive intermediates. This compound may exhibit various applications, including potential use in pharmaceuticals or agrochemicals, owing to its unique structural characteristics. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to regulatory considerations due to the presence of halogens.
Formula:C10H4BrClF3NO
InChI:InChI=1S/C10H4BrClF3NO/c11-7-4-16-8-2-1-5(17-10(13,14)15)3-6(8)9(7)12/h1-4H
InChI key:InChIKey=PEKHWXZGWJQUHH-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=CC(OC(F)(F)F)=C2)N=CC1Br
Synonyms:
  • 3-Bromo-4-chloro-6-(trifluoromethoxy)quinoline
  • Quinoline, 3-bromo-4-chloro-6-(trifluoromethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.