
CAS 1204811-70-0
:3,5-Dichloro-8-methoxy-4-quinolinol
Description:
3,5-Dichloro-8-methoxy-4-quinolinol is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features two chlorine atoms at the 3 and 5 positions and a methoxy group at the 8 position of the quinoline ring, contributing to its unique chemical properties. It is typically recognized for its potential biological activity, particularly in the context of medicinal chemistry, where it may exhibit antimicrobial or antiprotozoal properties. The presence of chlorine atoms can enhance lipophilicity, potentially affecting the compound's bioavailability and interaction with biological targets. Additionally, the methoxy group can influence the compound's solubility and reactivity. As with many quinoline derivatives, 3,5-Dichloro-8-methoxy-4-quinolinol may be of interest in research related to drug development and synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C10H7Cl2NO2
InChI:InChI=1S/C10H7Cl2NO2/c1-15-7-3-2-5(11)8-9(7)13-4-6(12)10(8)14/h2-4H,1H3,(H,13,14)
InChI key:InChIKey=QAJRREVOUVVPSY-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C(O)=C(Cl)C=N2)C(Cl)=CC1
Synonyms:- 3,5-Dichloro-8-methoxy-4-quinolinol
- 4-Quinolinol, 3,5-dichloro-8-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.