CAS 1204811-81-3

3,8-Dichloro-5-methoxy-4-quinolinol

Description:

3,8-Dichloro-5-methoxy-4-quinolinol is a synthetic chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features two chlorine atoms at the 3 and 8 positions and a methoxy group at the 5 position of the quinoline ring, contributing to its unique chemical properties. The presence of chlorine atoms typically enhances the compound's lipophilicity and may influence its biological activity, while the methoxy group can affect solubility and reactivity. This compound may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural characteristics that can interact with biological targets. Additionally, its specific functional groups may impart antimicrobial or antitumor properties, making it of interest in drug discovery. As with many quinoline derivatives, the compound's behavior in biological systems and its environmental impact would require thorough investigation through experimental studies.

Formula: C₁₀H₇Cl₂NO₂

InChI: InChI=1S/C10H7Cl2NO2/c1-15-7-3-2-5(11)9-8(7)10(14)6(12)4-13-9/h2-4H,1H3,(H,13,14)

InChI key: InChIKey=IBZWLZMKGPUXKM-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C(Cl)=CC1)N=CC(Cl)=C2O

Synonyms:

• 3,8-Dichloro-5-methoxy-4-quinolinol
• 4-Quinolinol, 3,8-dichloro-5-methoxy-