CAS 1204812-10-1

3,6-Dichloro-8-methoxy-4-quinolinol

Description:

3,6-Dichloro-8-methoxy-4-quinolinol is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features two chlorine atoms at the 3 and 6 positions and a methoxy group (-OCH3) at the 8 position, contributing to its unique chemical properties. The presence of the hydroxyl group (-OH) at the 4 position enhances its potential for hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its chlorinated and methoxy substituents can affect its lipophilicity and interaction with biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many quinoline derivatives, it may possess antimicrobial or antimalarial properties, although specific biological activities would require further investigation. Proper handling and safety measures should be observed due to the presence of chlorine, which can pose health risks.

Formula: C₁₀H₇Cl₂NO₂

InChI: InChI=1S/C10H7Cl2NO2/c1-15-8-3-5(11)2-6-9(8)13-4-7(12)10(6)14/h2-4H,1H3,(H,13,14)

InChI key: InChIKey=NXBKQSICYIDESP-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C=C(Cl)C1)C(O)=C(Cl)C=N2

Synonyms:

• 4-Quinolinol, 3,6-dichloro-8-methoxy-
• 3,6-Dichloro-8-methoxy-4-quinolinol