
CAS 1204812-91-8
:N-(Carboxymethyl)-N-[(1,1-dimethylethoxy)carbonyl]glycine 1-ethyl ester
Description:
N-(Carboxymethyl)-N-[(1,1-dimethylethoxy)carbonyl]glycine 1-ethyl ester, identified by its CAS number 1204812-91-8, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a carboxymethyl group and an ethyl ester functional group, which contribute to its solubility and reactivity. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective groups that can influence its reactivity in synthetic applications. Typically, compounds of this nature are utilized in organic synthesis, particularly in the preparation of peptides and other biologically relevant molecules. The structure suggests potential applications in pharmaceuticals and biochemistry, where modifications to amino acids are often required for drug development. Additionally, the compound may exhibit specific properties such as stability under certain conditions, and its solubility profile can vary depending on the solvent used. Overall, this compound is significant in the context of synthetic organic chemistry and medicinal chemistry.
Formula:C11H19NO6
InChI:InChI=1S/C11H19NO6/c1-5-17-9(15)7-12(6-8(13)14)10(16)18-11(2,3)4/h5-7H2,1-4H3,(H,13,14)
InChI key:InChIKey=UAFJWXKZXSDTDM-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(CC(OCC)=O)CC(O)=O
Synonyms:- Glycine, N-(carboxymethyl)-N-[(1,1-dimethylethoxy)carbonyl]-, 1-ethyl ester
- N-(Carboxymethyl)-N-[(1,1-dimethylethoxy)carbonyl]glycine 1-ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.